| MolName | 2-[(Z)-(diphenylphosphorylhydrazinylidene)methyl]furan |
| MolecularFormula | C17H15N2O2P |
| Smiles | O=P(c1ccccc1)(c1ccccc1)N/N=C\c1ccco1 |
| InChI | InChI=1S/C17H15N2O2P/c20-22(16-9-3-1-4-10-16,17-11-5-2-6-12-17)19-18-14-15-8-7-13-21-15/h1-14H,(H,19,20) |
| InChIK | CVMURIABQLZUNE-UHFFFAOYSA-N |
| TotalMolweight | 310.292 |
| Molweight | 310.292 |
| MonoisotopicMass | 310.087115 |
| CLogP | 3.5431 |
| CLogS | -4.334 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 242.46 |
| Relative PSA | 0.22313 |
| PolarSurfaceArea | 64.41 |
| Druglikeness | -12.246 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-(diphenylphosphorylhydrazinylidene)methyl]furan | 2 - 2-[(Z)-(diphenylphosphorylhydrazinylidene)methyl]furan