| MolName | 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C23H19N4O2ClS |
| Smiles | Oc1cccc(/C=N\NC(CSc2nc(cccc3)c3n2Cc(cccc2)c2Cl)=O)c1 |
| InChI | InChI=1S/C23H19ClN4O2S/c24-19-9-2-1-7-17(19)14-28-21-11-4-3-10-20(21)26-23(28)31-15-22(30)27-25-13-16-6-5-8-18(29)12-16/h1-13,29H,14-15H2,(H,27,30) |
| InChIK | CVSDOEDCDDEICH-UHFFFAOYSA-N |
| TotalMolweight | 450.949 |
| Molweight | 450.949 |
| MonoisotopicMass | 450.091723 |
| CLogP | 5.0067 |
| CLogS | -5.136 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 336.09 |
| Relative PSA | 0.25124 |
| PolarSurfaceArea | 104.81 |
| Druglikeness | 6.2517 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide | 2 - 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide