| MolName | (Z)-(3-bromo-4-fluorophenyl)methylidenehydrazine |
| MolecularFormula | C7H6N2BrF |
| Smiles | N/N=C\c(cc1)cc(Br)c1F |
| InChI | InChI=1S/C7H6BrFN2/c8-6-3-5(4-11-10)1-2-7(6)9/h1-4H,10H2 |
| InChIK | CVSVTZVVQLKCKF-UHFFFAOYSA-N |
| TotalMolweight | 217.041 |
| Molweight | 217.041 |
| MonoisotopicMass | 215.969837 |
| CLogP | 2.3928 |
| CLogS | -3.541 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 131.52 |
| Relative PSA | 0.20362 |
| PolarSurfaceArea | 38.38 |
| Druglikeness | -5.4646 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 11 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 1 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-(3-bromo-4-fluorophenyl)methylidenehydrazine | 2 - (Z)-(3-bromo-4-fluorophenyl)methylidenehydrazine