| MolName | N-[(Z)-3-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C21H15N5O7 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(/C(/NC(c2ccccc2)=O)=C/c2cccc([N+]([O-])=O)c2)=O)o1)=O |
| InChI | InChI=1S/C21H15N5O7/c27-20(15-6-2-1-3-7-15)23-18(12-14-5-4-8-16(11-14)25(29)30)21(28)24-22-13-17-9-10-19(33-17)26(31)32/h1-13H,(H,23,27)(H,24,28) |
| InChIK | CVXNEZQPVVUKPS-UHFFFAOYSA-N |
| TotalMolweight | 449.378 |
| Molweight | 449.378 |
| MonoisotopicMass | 449.09715 |
| CLogP | 2.5152 |
| CLogS | -6.593 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 337.7 |
| Relative PSA | 0.40113 |
| PolarSurfaceArea | 175.34 |
| Druglikeness | 4.5295 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-3-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(Z)-3-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide