| MolName | 4-amino-N-[(Z)-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C17H11N5O3Br2Cl2 |
| Smiles | Nc1nonc1C(N/N=C\c1cc(Br)cc(Br)c1OCc(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C17H11Br2Cl2N5O3/c18-10-3-9(6-23-24-17(27)14-16(22)26-29-25-14)15(12(19)4-10)28-7-8-1-2-11(20)5-13(8)21/h1-6H,7H2,(H2,22,26)(H,24,27) |
| InChIK | CWUYGTAXQDMQRT-UHFFFAOYSA-N |
| TotalMolweight | 564.02 |
| Molweight | 564.02 |
| MonoisotopicMass | 560.860566 |
| CLogP | 5.4515 |
| CLogS | -7.07 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 334.34 |
| Relative PSA | 0.29111 |
| PolarSurfaceArea | 115.63 |
| Druglikeness | 4.2105 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide