| MolName | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C18H16N4OS |
| Smiles | O=C(CSc1nc(cccc2)c2[nH]1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C18H16N4OS/c23-17(22-19-12-6-9-14-7-2-1-3-8-14)13-24-18-20-15-10-4-5-11-16(15)21-18/h1-12H,13H2,(H,20,21)(H,22,23) |
| InChIK | CXNBNCCMDHOYEN-UHFFFAOYSA-N |
| TotalMolweight | 336.418 |
| Molweight | 336.418 |
| MonoisotopicMass | 336.104481 |
| CLogP | 3.2744 |
| CLogS | -4.535 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 267.67 |
| Relative PSA | 0.29312 |
| PolarSurfaceArea | 95.44 |
| Druglikeness | 5.0071 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide