| MolName | N-[(Z)-(2,6-difluorophenyl)methylideneamino]-2-phenylacetamide |
| MolecularFormula | C15H12N2OF2 |
| Smiles | O=C(Cc1ccccc1)N/N=C\c(c(F)ccc1)c1F |
| InChI | InChI=1S/C15H12F2N2O/c16-13-7-4-8-14(17)12(13)10-18-19-15(20)9-11-5-2-1-3-6-11/h1-8,10H,9H2,(H,19,20) |
| InChIK | CXRMQRMDYJKSBF-UHFFFAOYSA-N |
| TotalMolweight | 274.269 |
| Molweight | 274.269 |
| MonoisotopicMass | 274.091769 |
| CLogP | 3.4013 |
| CLogS | -4.314 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 213.45 |
| Relative PSA | 0.1687 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 3.0305 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,6-difluorophenyl)methylideneamino]-2-phenylacetamide | 2 - N-[(Z)-(2,6-difluorophenyl)methylideneamino]-2-phenylacetamide