| MolName | [(Z)-(5,6,7,8-tetrachloro-9,10-dioxoanthracen-2-yl)methylideneamino]urea |
| MolecularFormula | C16H7N3O3Cl4 |
| Smiles | NC(N/N=C\c(cc1)cc(C(c(c2c(c(Cl)c3Cl)Cl)c3Cl)=O)c1C2=O)=O |
| InChI | InChI=1S/C16H7Cl4N3O3/c17-10-8-9(11(18)13(20)12(10)19)15(25)7-3-5(4-22-23-16(21)26)1-2-6(7)14(8)24/h1-4H,(H3,21,23,26) |
| InChIK | CYBSBTNKSRIPRV-UHFFFAOYSA-N |
| TotalMolweight | 431.062 |
| Molweight | 431.062 |
| MonoisotopicMass | 428.92415 |
| CLogP | 4.9331 |
| CLogS | -8.872 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 279.19 |
| Relative PSA | 0.27709 |
| PolarSurfaceArea | 101.62 |
| Druglikeness | 4.6064 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-(5,6,7,8-tetrachloro-9,10-dioxoanthracen-2-yl)methylideneamino]urea | 2 - [(Z)-(5,6,7,8-tetrachloro-9,10-dioxoanthracen-2-yl)methylideneamino]urea