| MolName | [4-[(Z)-(benzoylhydrazinylidene)methyl]-2,6-dibromophenyl] 3,5-dinitrobenzoate |
| MolecularFormula | C21H12N4O7Br2 |
| Smiles | [O-][N+](c1cc(C(Oc(c(Br)cc(/C=N\NC(c2ccccc2)=O)c2)c2Br)=O)cc([N+]([O-])=O)c1)=O |
| InChI | InChI=1S/C21H12Br2N4O7/c22-17-6-12(11-24-25-20(28)13-4-2-1-3-5-13)7-18(23)19(17)34-21(29)14-8-15(26(30)31)10-16(9-14)27(32)33/h1-11H,(H,25,28) |
| InChIK | CYSZUSQWHZQTHA-UHFFFAOYSA-N |
| TotalMolweight | 592.155 |
| Molweight | 592.155 |
| MonoisotopicMass | 589.907273 |
| CLogP | 4.2393 |
| CLogS | -7.779 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 359.1 |
| Relative PSA | 0.33386 |
| PolarSurfaceArea | 159.4 |
| Druglikeness | -2.8781 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 10 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-(benzoylhydrazinylidene)methyl]-2,6-dibromophenyl] 3,5-dinitrobenzoate | 2 - [4-[(Z)-(benzoylhydrazinylidene)methyl]-2,6-dibromophenyl] 3,5-dinitrobenzoate