| MolName | (Z)-N-cyclohexyl-4-(furan-2-yl)-3-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-2-imine |
| MolecularFormula | C19H20N4OS |
| Smiles | C(CC1)CCC1/N=C1\SC=C(c2ccco2)N1/N=C\c1ncccc1 |
| InChI | InChI=1S/C19H20N4OS/c1-2-7-15(8-3-1)22-19-23(21-13-16-9-4-5-11-20-16)17(14-25-19)18-10-6-12-24-18/h4-6,9-15H,1-3,7-8H2 |
| InChIK | CYWSBERFUNYQQW-UHFFFAOYSA-N |
| TotalMolweight | 352.461 |
| Molweight | 352.461 |
| MonoisotopicMass | 352.135781 |
| CLogP | 3.8475 |
| CLogS | -4.957 |
| H Acceptors | 5 |
| TotalSurfaceArea | 276 |
| Relative PSA | 0.25051 |
| PolarSurfaceArea | 79.29 |
| Druglikeness | -2.7114 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-cyclohexyl-4-(furan-2-yl)-3-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-2-imine | 2 - (Z)-N-cyclohexyl-4-(furan-2-yl)-3-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-2-imine