| MolName | [4-[(Z)-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]phenyl] pyridine-3-carboxylate |
| MolecularFormula | C25H16N4O3S |
| Smiles | O=C(c1cnccc1)Oc1ccc(/C=N\N(C=Nc2c3c(-c4ccccc4)cs2)C3=O)cc1 |
| InChI | InChI=1S/C25H16N4O3S/c30-24-22-21(18-5-2-1-3-6-18)15-33-23(22)27-16-29(24)28-13-17-8-10-20(11-9-17)32-25(31)19-7-4-12-26-14-19/h1-16H |
| InChIK | CYZXPADJVDHAPE-UHFFFAOYSA-N |
| TotalMolweight | 452.493 |
| Molweight | 452.493 |
| MonoisotopicMass | 452.094311 |
| CLogP | 4.5348 |
| CLogS | -6.61 |
| H Acceptors | 7 |
| TotalSurfaceArea | 339.06 |
| Relative PSA | 0.27718 |
| PolarSurfaceArea | 112.46 |
| Druglikeness | 5.4427 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.60606 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]phenyl] pyridine-3-carboxylate | 2 - [4-[(Z)-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]phenyl] pyridine-3-carboxylate