| MolName | N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| MolecularFormula | C17H18N3OBr |
| Smiles | Brc(cc1)ccc1-c1ccc(/C=N\NC2=NCCCCC2)o1 |
| InChI | InChI=1S/C17H18BrN3O/c18-14-7-5-13(6-8-14)16-10-9-15(22-16)12-20-21-17-4-2-1-3-11-19-17/h5-10,12H,1-4,11H2,(H,19,21) |
| InChIK | CZESFMGWHHQIPT-UHFFFAOYSA-N |
| TotalMolweight | 360.254 |
| Molweight | 360.254 |
| MonoisotopicMass | 359.063323 |
| CLogP | 4.1477 |
| CLogS | -5.827 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 255.83 |
| Relative PSA | 0.18993 |
| PolarSurfaceArea | 49.89 |
| Druglikeness | -1.4123 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine | 2 - N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine