| MolName | 6-N-benzyl-2-N-[(Z)-(4-chlorophenyl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C23H19N8O2Cl |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(NCc2ccccc2)nc(N/N=C\c(cc2)ccc2Cl)n1)=O |
| InChI | InChI=1S/C23H19ClN8O2/c24-18-8-6-17(7-9-18)15-26-31-23-29-21(25-14-16-4-2-1-3-5-16)28-22(30-23)27-19-10-12-20(13-11-19)32(33)34/h1-13,15H,14H2,(H3,25,27,28,29,30,31) |
| InChIK | CZQPHVYGFJJWLC-UHFFFAOYSA-N |
| TotalMolweight | 474.911 |
| Molweight | 474.911 |
| MonoisotopicMass | 474.131949 |
| CLogP | 6.0312 |
| CLogS | -7.492 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 360.81 |
| Relative PSA | 0.30271 |
| PolarSurfaceArea | 132.94 |
| Druglikeness | -2.4788 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-N-benzyl-2-N-[(Z)-(4-chlorophenyl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine | 2 - 6-N-benzyl-2-N-[(Z)-(4-chlorophenyl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine