| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| MolecularFormula | C30H21N6OClS |
| Smiles | O=C(CSc1nnc(-c2ccncc2)n1-c(cc1)ccc1Cl)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C30H21ClN6OS/c31-23-9-11-24(12-10-23)37-29(20-13-15-32-16-14-20)35-36-30(37)39-19-28(38)34-33-18-27-25-7-3-1-5-21(25)17-22-6-2-4-8-26(22)27/h1-18H,19H2,(H,34,38) |
| InChIK | CZZCEULXBZOBDY-UHFFFAOYSA-N |
| TotalMolweight | 549.057 |
| Molweight | 549.057 |
| MonoisotopicMass | 548.118606 |
| CLogP | 6.5257 |
| CLogS | -11.569 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 407.86 |
| Relative PSA | 0.22871 |
| PolarSurfaceArea | 110.36 |
| Druglikeness | 5.4489 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46154 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 31 |
| Sp3Atoms | 2 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide