| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C28H23N9O3Cl2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cccc(OCc(ccc(Cl)c3)c3Cl)c2)=O)c1CN(CC1)c2c1cccc2 |
| InChI | InChI=1S/C28H23Cl2N9O3/c29-20-9-8-19(22(30)13-20)16-41-21-6-3-4-17(12-21)14-32-34-28(40)25-24(39(37-33-25)27-26(31)35-42-36-27)15-38-11-10-18-5-1-2-7-23(18)38/h1-9,12-14H,10-11,15-16H2,(H2,31,35)(H,34,40) |
| InChIK | DAAXHFAKKPAJET-UHFFFAOYSA-N |
| TotalMolweight | 604.457 |
| Molweight | 604.457 |
| MonoisotopicMass | 603.13009 |
| CLogP | 5.7614 |
| CLogS | -5.973 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 441.4 |
| Relative PSA | 0.29382 |
| PolarSurfaceArea | 149.58 |
| Druglikeness | 3.1871 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52381 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide