| MolName | 2-N-[(Z)-naphthalen-1-ylmethylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C26H21N7 |
| Smiles | C(c1cccc2ccccc12)=N\Nc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C26H21N7/c1-3-13-21(14-4-1)28-24-30-25(29-22-15-5-2-6-16-22)32-26(31-24)33-27-18-20-12-9-11-19-10-7-8-17-23(19)20/h1-18H,(H3,28,29,30,31,32,33) |
| InChIK | DAMCVOWUYMLPHB-UHFFFAOYSA-N |
| TotalMolweight | 431.502 |
| Molweight | 431.502 |
| MonoisotopicMass | 431.185843 |
| CLogP | 8.5177 |
| CLogS | -8.097 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 342.56 |
| Relative PSA | 0.23003 |
| PolarSurfaceArea | 87.12 |
| Druglikeness | 2.5594 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Symmetricatoms | 11 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-naphthalen-1-ylmethylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine | 2 - 2-N-[(Z)-naphthalen-1-ylmethylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine