| MolName | N-[(Z)-(2-fluorophenyl)methylideneamino]-2-oxo-2-pyrrolidin-1-ylacetamide |
| MolecularFormula | C13H14N3O2F |
| Smiles | O=C(C(N1CCCC1)=O)N/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C13H14FN3O2/c14-11-6-2-1-5-10(11)9-15-16-12(18)13(19)17-7-3-4-8-17/h1-2,5-6,9H,3-4,7-8H2,(H,16,18) |
| InChIK | DARAWKWAAJEBSD-UHFFFAOYSA-N |
| TotalMolweight | 263.271 |
| Molweight | 263.271 |
| MonoisotopicMass | 263.107005 |
| CLogP | 1.5935 |
| CLogS | -2.656 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 203.17 |
| Relative PSA | 0.2589 |
| PolarSurfaceArea | 61.77 |
| Druglikeness | 4.1712 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-fluorophenyl)methylideneamino]-2-oxo-2-pyrrolidin-1-ylacetamide | 2 - N-[(Z)-(2-fluorophenyl)methylideneamino]-2-oxo-2-pyrrolidin-1-ylacetamide