| MolName | 3-[[5-[(Z)-(carbamoylhydrazinylidene)methyl]-4-chloro-2-oxo-1,3-thiazol-3-yl]methyl]benzoate |
| MolecularFormula | C13H10N4O4ClS |
| Smiles | NC(N/N=C\C(SC(N1Cc2cc(C([O-])=O)ccc2)=O)=C1Cl)=O |
| InChI | InChI=1S/C13H11ClN4O4S/c14-10-9(5-16-17-12(15)21)23-13(22)18(10)6-7-2-1-3-8(4-7)11(19)20/h1-5H,6H2,(H,19,20)(H3,15,17,21)/p-1 |
| InChIK | DAYQFLYJPUHGGM-UHFFFAOYSA-M |
| TotalMolweight | 353.765 |
| Molweight | 353.765 |
| MonoisotopicMass | 353.011128 |
| CLogP | -1.0853 |
| CLogS | -4.434 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 245.17 |
| Relative PSA | 0.4596 |
| PolarSurfaceArea | 153.22 |
| Druglikeness | 7.3913 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 3 |
| Amides | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[5-[(Z)-(carbamoylhydrazinylidene)methyl]-4-chloro-2-oxo-1,3-thiazol-3-yl]methyl]benzoate | 2 - 3-[[5-[(Z)-(carbamoylhydrazinylidene)methyl]-4-chloro-2-oxo-1,3-thiazol-3-yl]methyl]benzoate