| MolName | (Z)-N-(4-benzhydrylpiperazin-1-yl)-1-(2-nitrophenyl)methanimine |
| MolecularFormula | C24H24N4O2 |
| Smiles | [O-][N+](c1c(/C=N\N(CC2)CCN2C(c2ccccc2)c2ccccc2)cccc1)=O |
| InChI | InChI=1S/C24H24N4O2/c29-28(30)23-14-8-7-13-22(23)19-25-27-17-15-26(16-18-27)24(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-14,19,24H,15-18H2 |
| InChIK | DAZRAHOZBHAUML-UHFFFAOYSA-N |
| TotalMolweight | 400.481 |
| Molweight | 400.481 |
| MonoisotopicMass | 400.189926 |
| CLogP | 2.8867 |
| CLogS | -4.376 |
| H Acceptors | 6 |
| TotalSurfaceArea | 315.85 |
| Relative PSA | 0.15523 |
| PolarSurfaceArea | 64.66 |
| Druglikeness | 1.5485 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 10 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(4-benzhydrylpiperazin-1-yl)-1-(2-nitrophenyl)methanimine | 2 - (Z)-N-(4-benzhydrylpiperazin-1-yl)-1-(2-nitrophenyl)methanimine