| MolName | 2-(3-nitro-1,2,4-triazol-1-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C13H12N6O3 |
| Smiles | [O-][N+](c1nn(CC(N/N=C\C=C\c2ccccc2)=O)cn1)=O |
| InChI | InChI=1S/C13H12N6O3/c20-12(9-18-10-14-13(17-18)19(21)22)16-15-8-4-7-11-5-2-1-3-6-11/h1-8,10H,9H2,(H,16,20) |
| InChIK | DBEHXIZRPDQDHC-UHFFFAOYSA-N |
| TotalMolweight | 300.277 |
| Molweight | 300.277 |
| MonoisotopicMass | 300.097089 |
| CLogP | 0.101 |
| CLogS | -3.355 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 237.64 |
| Relative PSA | 0.40077 |
| PolarSurfaceArea | 117.99 |
| Druglikeness | 1.3769 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(3-nitro-1,2,4-triazol-1-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-(3-nitro-1,2,4-triazol-1-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide