| MolName | [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] benzoate |
| MolecularFormula | C31H21N3O6Br2 |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C/c(cc1)cc2c1OCO2)N/N=C\c1cc(Br)cc(Br)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C31H21Br2N3O6/c32-23-15-22(28(24(33)16-23)42-31(39)21-9-5-2-6-10-21)17-34-36-30(38)25(35-29(37)20-7-3-1-4-8-20)13-19-11-12-26-27(14-19)41-18-40-26/h1-17H,18H2,(H,35,37)(H,36,38) |
| InChIK | DBGSJDWPYBTDJP-UHFFFAOYSA-N |
| TotalMolweight | 691.331 |
| Molweight | 691.331 |
| MonoisotopicMass | 688.979709 |
| CLogP | 7.8106 |
| CLogS | -9.315 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 445.7 |
| Relative PSA | 0.23233 |
| PolarSurfaceArea | 115.32 |
| Druglikeness | 4.3154 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45238 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] benzoate | 2 - [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] benzoate