| MolName | 4-[(3,4-dichlorophenyl)methoxy]-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide |
| MolecularFormula | C21H15N3O4Cl2 |
| Smiles | [O-][N+](c1cccc(/C=N\NC(c(cc2)ccc2OCc(cc2)cc(Cl)c2Cl)=O)c1)=O |
| InChI | InChI=1S/C21H15Cl2N3O4/c22-19-9-4-15(11-20(19)23)13-30-18-7-5-16(6-8-18)21(27)25-24-12-14-2-1-3-17(10-14)26(28)29/h1-12H,13H2,(H,25,27) |
| InChIK | DBTZWOQVWFRVBA-UHFFFAOYSA-N |
| TotalMolweight | 444.273 |
| Molweight | 444.273 |
| MonoisotopicMass | 443.043961 |
| CLogP | 4.8401 |
| CLogS | -6.994 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 325.02 |
| Relative PSA | 0.23515 |
| PolarSurfaceArea | 96.51 |
| Druglikeness | -1.0722 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(3,4-dichlorophenyl)methoxy]-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide | 2 - 4-[(3,4-dichlorophenyl)methoxy]-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide