| MolName | 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C22H23N7O2 |
| Smiles | C1Oc(cc(/C=N\Nc2nc(N3CCCCC3)nc(Nc3ccccc3)n2)cc2)c2O1 |
| InChI | InChI=1S/C22H23N7O2/c1-3-7-17(8-4-1)24-20-25-21(27-22(26-20)29-11-5-2-6-12-29)28-23-14-16-9-10-18-19(13-16)31-15-30-18/h1,3-4,7-10,13-14H,2,5-6,11-12,15H2,(H2,24,25,26,27,28) |
| InChIK | DCHZUJBSTXIBMK-UHFFFAOYSA-N |
| TotalMolweight | 417.472 |
| Molweight | 417.472 |
| MonoisotopicMass | 417.191323 |
| CLogP | 6.7373 |
| CLogS | -6.616 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 322.6 |
| Relative PSA | 0.28174 |
| PolarSurfaceArea | 96.79 |
| Druglikeness | 2.5845 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine