| MolName | (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| MolecularFormula | C17H17N7O4Cl2 |
| Smiles | Nc1ncnc2c1nc(N/N=C\c(c(Cl)ccc1)c1Cl)n2[C@H]([C@H]1O)O[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C17H17Cl2N7O4/c18-8-2-1-3-9(19)7(8)4-23-25-17-24-11-14(20)21-6-22-15(11)26(17)16-13(29)12(28)10(5-27)30-16/h1-4,6,10,12-13,16,27-29H,5H2,(H,24,25)(H2,20,21,22)/t10-,12-,13+,16+/m1/s1 |
| InChIK | DCVZMPNQAMHMMK-KBNOKHGBSA-N |
| TotalMolweight | 454.273 |
| Molweight | 454.273 |
| MonoisotopicMass | 453.071907 |
| CLogP | 3.0232 |
| CLogS | -5.601 |
| H Acceptors | 11 |
| H Donors | 5 |
| TotalSurfaceArea | 307.99 |
| Relative PSA | 0.41339 |
| PolarSurfaceArea | 163.93 |
| Druglikeness | 1.3996 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| StereoCenters | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 9 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol | 2 - (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol