| MolName | 6-morpholin-4-yl-2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C21H19N9O7 |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(N/N=C\c(cc2OCOc2c2)c2[N+]([O-])=O)nc(N2CCOCC2)n1)=O |
| InChI | InChI=1S/C21H19N9O7/c31-29(32)15-3-1-14(2-4-15)23-19-24-20(26-21(25-19)28-5-7-35-8-6-28)27-22-11-13-9-17-18(37-12-36-17)10-16(13)30(33)34/h1-4,9-11H,5-8,12H2,(H2,23,24,25,26,27) |
| InChIK | DDBBBZZZICYXRG-UHFFFAOYSA-N |
| TotalMolweight | 509.438 |
| Molweight | 509.438 |
| MonoisotopicMass | 509.140746 |
| CLogP | 3.2189 |
| CLogS | -6.647 |
| H Acceptors | 16 |
| H Donors | 2 |
| TotalSurfaceArea | 366.18 |
| Relative PSA | 0.44167 |
| PolarSurfaceArea | 197.66 |
| Druglikeness | -1.7936 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.48649 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 10 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 6-morpholin-4-yl-2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine | 2 - 6-morpholin-4-yl-2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine