| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]formamide |
| MolecularFormula | C8H6N2OCl2 |
| Smiles | O=CN/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C8H6Cl2N2O/c9-7-2-1-6(8(10)3-7)4-11-12-5-13/h1-5H,(H,12,13) |
| InChIK | DDFQYHXCMSAYIV-UHFFFAOYSA-N |
| TotalMolweight | 217.055 |
| Molweight | 217.055 |
| MonoisotopicMass | 215.985717 |
| CLogP | 2.599 |
| CLogS | -4.192 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 159.86 |
| Relative PSA | 0.22526 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 2.2236 |
| Mutagenic | low |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.76923 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 2 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]formamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]formamide