| MolName | 4-[(Z)-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C22H15N4OCl3S |
| Smiles | S=C(NN=C1c2ccccc2)N1/N=C\c(cc1)cc(Cl)c1OCc(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C22H15Cl3N4OS/c23-17-8-6-15(11-18(17)24)13-30-20-9-7-14(10-19(20)25)12-26-29-21(27-28-22(29)31)16-4-2-1-3-5-16/h1-12H,13H2,(H,28,31) |
| InChIK | DDFSQHDPDGLWKW-UHFFFAOYSA-N |
| TotalMolweight | 489.813 |
| Molweight | 489.813 |
| MonoisotopicMass | 488.003212 |
| CLogP | 6.4611 |
| CLogS | -8 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 351.5 |
| Relative PSA | 0.2163 |
| PolarSurfaceArea | 81.31 |
| Druglikeness | 3.229 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione