| MolName | N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| MolecularFormula | C31H24N8OS |
| Smiles | O=C(CSc1nnc(-c2ccncc2)n1-c1ccccc1)N/N=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C31H24N8OS/c40-28(22-41-31-36-35-30(24-16-18-32-19-17-24)39(31)27-14-8-3-9-15-27)34-33-20-25-21-38(26-12-6-2-7-13-26)37-29(25)23-10-4-1-5-11-23/h1-21H,22H2,(H,34,40) |
| InChIK | DDISZPFVNPVLJI-UHFFFAOYSA-N |
| TotalMolweight | 556.653 |
| Molweight | 556.653 |
| MonoisotopicMass | 556.179377 |
| CLogP | 4.4499 |
| CLogS | -9.134 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 430.72 |
| Relative PSA | 0.25799 |
| PolarSurfaceArea | 128.18 |
| Druglikeness | 6.5417 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.4878 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 34 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide | 2 - N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide