| MolName | N-[(Z)-(4-chlorophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
| MolecularFormula | C23H16N3OCl |
| Smiles | O=C(c1cc(-c2ccccc2)nc2ccccc12)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C23H16ClN3O/c24-18-12-10-16(11-13-18)15-25-27-23(28)20-14-22(17-6-2-1-3-7-17)26-21-9-5-4-8-19(20)21/h1-15H,(H,27,28) |
| InChIK | DDOJVMQCMWJWBI-UHFFFAOYSA-N |
| TotalMolweight | 385.853 |
| Molweight | 385.853 |
| MonoisotopicMass | 385.098189 |
| CLogP | 5.8738 |
| CLogS | -6.941 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 295.53 |
| Relative PSA | 0.15897 |
| PolarSurfaceArea | 54.35 |
| Druglikeness | 4.4715 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide | 2 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide