| MolName | 1-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-3-phenylthiourea |
| MolecularFormula | C23H19N4FS |
| Smiles | Fc1ccc(Cn2c(cccc3)c3c(/C=N\NC(Nc3ccccc3)=S)c2)cc1 |
| InChI | InChI=1S/C23H19FN4S/c24-19-12-10-17(11-13-19)15-28-16-18(21-8-4-5-9-22(21)28)14-25-27-23(29)26-20-6-2-1-3-7-20/h1-14,16H,15H2,(H2,26,27,29) |
| InChIK | DDZHNVHZUYNBKC-UHFFFAOYSA-N |
| TotalMolweight | 402.496 |
| Molweight | 402.496 |
| MonoisotopicMass | 402.131444 |
| CLogP | 5.2227 |
| CLogS | -5.613 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 317.08 |
| Relative PSA | 0.21856 |
| PolarSurfaceArea | 73.44 |
| Druglikeness | 2.9346 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-3-phenylthiourea | 2 - 1-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-3-phenylthiourea