| MolName | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C28H27N9O4 |
| Smiles | Nc1nonc1-n1nnc(CN2CCOCC2)c1C(N/N=C\c(cccc1)c1OCc1cccc2ccccc12)=O |
| InChI | InChI=1S/C28H27N9O4/c29-26-27(34-41-33-26)37-25(23(31-35-37)17-36-12-14-39-15-13-36)28(38)32-30-16-20-7-2-4-11-24(20)40-18-21-9-5-8-19-6-1-3-10-22(19)21/h1-11,16H,12-15,17-18H2,(H2,29,33)(H,32,38) |
| InChIK | DEAFUXHLQLOKJV-UHFFFAOYSA-N |
| TotalMolweight | 553.581 |
| Molweight | 553.581 |
| MonoisotopicMass | 553.218601 |
| CLogP | 3.8838 |
| CLogS | -3.98 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 422.92 |
| Relative PSA | 0.3303 |
| PolarSurfaceArea | 158.81 |
| Druglikeness | 2.4171 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.4878 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 9 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]triazole-4-carboxamide | 2 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]triazole-4-carboxamide