| MolName | (Z)-N-[(Z)-(2,6-difluorophenyl)methylideneamino]-1,1-diphenylmethanimine |
| MolecularFormula | C20H14N2F2 |
| Smiles | Fc1cccc(F)c1/C=N\N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H14F2N2/c21-18-12-7-13-19(22)17(18)14-23-24-20(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-14H |
| InChIK | DEGRDBCLWPRJNS-UHFFFAOYSA-N |
| TotalMolweight | 320.341 |
| Molweight | 320.341 |
| MonoisotopicMass | 320.112504 |
| CLogP | 6.1839 |
| CLogS | -6.536 |
| H Acceptors | 2 |
| TotalSurfaceArea | 253.21 |
| Relative PSA | 0.090913 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | 0.60187 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 11 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-(2,6-difluorophenyl)methylideneamino]-1,1-diphenylmethanimine | 2 - (Z)-N-[(Z)-(2,6-difluorophenyl)methylideneamino]-1,1-diphenylmethanimine