| MolName | 2-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]guanidine |
| MolecularFormula | C12H17N5O |
| Smiles | NC(N)=N/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C12H17N5O/c13-12(14)16-15-9-10-1-3-11(4-2-10)17-5-7-18-8-6-17/h1-4,9H,5-8H2,(H4,13,14,16) |
| InChIK | DEKLEPKHEPCFMW-UHFFFAOYSA-N |
| TotalMolweight | 247.301 |
| Molweight | 247.301 |
| MonoisotopicMass | 247.14331 |
| CLogP | 1.5423 |
| CLogS | -3.093 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 199.87 |
| Relative PSA | 0.33577 |
| PolarSurfaceArea | 89.23 |
| Druglikeness | 2.9651 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.72222 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 5 |
| Symmetricatoms | 5 |
| Amines | 1 |
| Aromatic Amines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]guanidine | 2 - 2-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]guanidine