| MolName | 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(Z)-pyridin-2-ylmethylideneamino]acetamide |
| MolecularFormula | C22H18N5OClS |
| Smiles | O=C(CSc1nc(cccc2)c2n1Cc(cccc1)c1Cl)N/N=C\c1ncccc1 |
| InChI | InChI=1S/C22H18ClN5OS/c23-18-9-2-1-7-16(18)14-28-20-11-4-3-10-19(20)26-22(28)30-15-21(29)27-25-13-17-8-5-6-12-24-17/h1-13H,14-15H2,(H,27,29) |
| InChIK | DEVYCVWXDYWSGZ-UHFFFAOYSA-N |
| TotalMolweight | 435.938 |
| Molweight | 435.938 |
| MonoisotopicMass | 435.092057 |
| CLogP | 4.4055 |
| CLogS | -4.661 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 328.5 |
| Relative PSA | 0.25056 |
| PolarSurfaceArea | 97.47 |
| Druglikeness | 6.2732 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(Z)-pyridin-2-ylmethylideneamino]acetamide | 2 - 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(Z)-pyridin-2-ylmethylideneamino]acetamide