| MolName | 6-N-benzyl-2-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C23H19N7Cl2 |
| Smiles | Clc1cccc(Cl)c1/C=N\Nc1nc(Nc2ccccc2)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C23H19Cl2N7/c24-19-12-7-13-20(25)18(19)15-27-32-23-30-21(26-14-16-8-3-1-4-9-16)29-22(31-23)28-17-10-5-2-6-11-17/h1-13,15H,14H2,(H3,26,28,29,30,31,32) |
| InChIK | DEYYETFDTGEHTE-UHFFFAOYSA-N |
| TotalMolweight | 464.359 |
| Molweight | 464.359 |
| MonoisotopicMass | 463.107897 |
| CLogP | 8.07 |
| CLogS | -7.768 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 352.56 |
| Relative PSA | 0.22351 |
| PolarSurfaceArea | 87.12 |
| Druglikeness | 2.9184 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 7 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 6-N-benzyl-2-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine | 2 - 6-N-benzyl-2-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine