| MolName | 4-amino-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C11H8N6O6 |
| Smiles | Nc1nonc1C(N/N=C\c(cc1OCOc1c1)c1[N+]([O-])=O)=O |
| InChI | InChI=1S/C11H8N6O6/c12-10-9(15-23-16-10)11(18)14-13-3-5-1-7-8(22-4-21-7)2-6(5)17(19)20/h1-3H,4H2,(H2,12,16)(H,14,18) |
| InChIK | DEZZFCNZMKCLAE-UHFFFAOYSA-N |
| TotalMolweight | 320.221 |
| Molweight | 320.221 |
| MonoisotopicMass | 320.050534 |
| CLogP | 0.6308 |
| CLogS | -3.76 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 226.65 |
| Relative PSA | 0.60777 |
| PolarSurfaceArea | 170.68 |
| Druglikeness | 1.0522 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide