| MolName | N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]benzenesulfonamide |
| MolecularFormula | C17H12N2O3Cl2S |
| Smiles | O=S(c1ccccc1)(N/N=C\c1ccc(-c(ccc(Cl)c2)c2Cl)o1)=O |
| InChI | InChI=1S/C17H12Cl2N2O3S/c18-12-6-8-15(16(19)10-12)17-9-7-13(24-17)11-20-21-25(22,23)14-4-2-1-3-5-14/h1-11,21H |
| InChIK | DFIUPFMEJSEMLL-UHFFFAOYSA-N |
| TotalMolweight | 395.265 |
| Molweight | 395.265 |
| MonoisotopicMass | 393.994567 |
| CLogP | 4.428 |
| CLogS | -4.848 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 278.11 |
| Relative PSA | 0.23609 |
| PolarSurfaceArea | 80.05 |
| Druglikeness | -0.96602 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]benzenesulfonamide | 2 - N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]benzenesulfonamide