| MolName | 2-(2-chlorophenoxy)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| MolecularFormula | C16H12N3O6Cl |
| Smiles | [O-][N+](c1c(/C=N\NC(COc(cccc2)c2Cl)=O)cc2OCOc2c1)=O |
| InChI | InChI=1S/C16H12ClN3O6/c17-11-3-1-2-4-13(11)24-8-16(21)19-18-7-10-5-14-15(26-9-25-14)6-12(10)20(22)23/h1-7H,8-9H2,(H,19,21) |
| InChIK | DFUKBPMPFWOVMX-UHFFFAOYSA-N |
| TotalMolweight | 377.739 |
| Molweight | 377.739 |
| MonoisotopicMass | 377.041464 |
| CLogP | 2.5723 |
| CLogS | -5.408 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 270.1 |
| Relative PSA | 0.35702 |
| PolarSurfaceArea | 114.97 |
| Druglikeness | -0.93177 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-chlorophenoxy)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide | 2 - 2-(2-chlorophenoxy)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide