| MolName | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C28H20N4O7 |
| Smiles | [O-][N+](c1cc(-c2ccc(/C=N\NC(/C(/NC(c3ccccc3)=O)=C\c(cc3)cc4c3OCO4)=O)o2)ccc1)=O |
| InChI | InChI=1S/C28H20N4O7/c33-27(19-5-2-1-3-6-19)30-23(13-18-9-11-25-26(14-18)38-17-37-25)28(34)31-29-16-22-10-12-24(39-22)20-7-4-8-21(15-20)32(35)36/h1-16H,17H2,(H,30,33)(H,31,34) |
| InChIK | DFXASVAVSJXZRM-UHFFFAOYSA-N |
| TotalMolweight | 524.488 |
| Molweight | 524.488 |
| MonoisotopicMass | 524.133201 |
| CLogP | 4.947 |
| CLogS | -8.097 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 394.05 |
| Relative PSA | 0.31732 |
| PolarSurfaceArea | 147.98 |
| Druglikeness | 2.9539 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide