| MolName | (Z)-1-(5-bromo-2-prop-2-ynoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C12H9N4OBr |
| Smiles | C#CCOc(cc1)c(/C=N\n2cnnc2)cc1Br |
| InChI | InChI=1S/C12H9BrN4O/c1-2-5-18-12-4-3-11(13)6-10(12)7-16-17-8-14-15-9-17/h1,3-4,6-9H,5H2 |
| InChIK | DFXOVHDZJCWRPL-UHFFFAOYSA-N |
| TotalMolweight | 305.134 |
| Molweight | 305.134 |
| MonoisotopicMass | 303.995972 |
| CLogP | 1.9107 |
| CLogS | -5.786 |
| H Acceptors | 5 |
| TotalSurfaceArea | 210.7 |
| Relative PSA | 0.23882 |
| PolarSurfaceArea | 52.3 |
| Druglikeness | 1.2748 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(5-bromo-2-prop-2-ynoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-(5-bromo-2-prop-2-ynoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine