| MolName | (Z)-1-(4-bromophenyl)-N-(1,2,4-triazol-1-yl)methanimine |
| MolecularFormula | C9H7N4Br |
| Smiles | Brc1ccc(/C=N\n2ncnc2)cc1 |
| InChI | InChI=1S/C9H7BrN4/c10-9-3-1-8(2-4-9)5-12-14-7-11-6-13-14/h1-7H |
| InChIK | DGFOBXHNKWDKRC-UHFFFAOYSA-N |
| TotalMolweight | 251.087 |
| Molweight | 251.087 |
| MonoisotopicMass | 249.985407 |
| CLogP | 2.406 |
| CLogS | -4.087 |
| H Acceptors | 4 |
| TotalSurfaceArea | 163.13 |
| Relative PSA | 0.24716 |
| PolarSurfaceArea | 43.07 |
| Druglikeness | 1.7485 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-bromophenyl)-N-(1,2,4-triazol-1-yl)methanimine | 2 - (Z)-1-(4-bromophenyl)-N-(1,2,4-triazol-1-yl)methanimine