| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]acridin-9-amine |
| MolecularFormula | C20H14N3Cl |
| Smiles | Clc1c(/C=N\Nc2c(cccc3)c3nc3ccccc23)cccc1 |
| InChI | InChI=1S/C20H14ClN3/c21-17-10-4-1-7-14(17)13-22-24-20-15-8-2-5-11-18(15)23-19-12-6-3-9-16(19)20/h1-13H,(H,23,24) |
| InChIK | DGIDDPPXGRLXAC-UHFFFAOYSA-N |
| TotalMolweight | 331.805 |
| Molweight | 331.805 |
| MonoisotopicMass | 331.087624 |
| CLogP | 7.0798 |
| CLogS | -6.092 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 252.62 |
| Relative PSA | 0.13435 |
| PolarSurfaceArea | 37.28 |
| Druglikeness | 2.3845 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]acridin-9-amine | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]acridin-9-amine