| MolName | (Z)-1-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C18H13N5Cl2 |
| Smiles | Clc(ccc(Cn1c(cccc2)c2c(/C=N\n2cnnc2)c1)c1)c1Cl |
| InChI | InChI=1S/C18H13Cl2N5/c19-16-6-5-13(7-17(16)20)9-24-10-14(8-23-25-11-21-22-12-25)15-3-1-2-4-18(15)24/h1-8,10-12H,9H2 |
| InChIK | DGLFEMWNVNYEDL-UHFFFAOYSA-N |
| TotalMolweight | 370.242 |
| Molweight | 370.242 |
| MonoisotopicMass | 369.054799 |
| CLogP | 3.97 |
| CLogS | -6.76 |
| H Acceptors | 5 |
| TotalSurfaceArea | 272.66 |
| Relative PSA | 0.17307 |
| PolarSurfaceArea | 48 |
| Druglikeness | 5.263 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine