| MolName | N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-hydroxybenzamide |
| MolecularFormula | C25H20N4O4 |
| Smiles | Oc(cc1)ccc1C(N/N=C\c1cn(-c2ccccc2)nc1-c(cc1)cc2c1OCCO2)=O |
| InChI | InChI=1S/C25H20N4O4/c30-21-9-6-17(7-10-21)25(31)27-26-15-19-16-29(20-4-2-1-3-5-20)28-24(19)18-8-11-22-23(14-18)33-13-12-32-22/h1-11,14-16,30H,12-13H2,(H,27,31) |
| InChIK | DGLWZZJRNOWKAG-UHFFFAOYSA-N |
| TotalMolweight | 440.458 |
| Molweight | 440.458 |
| MonoisotopicMass | 440.148456 |
| CLogP | 3.7537 |
| CLogS | -5.12 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 334.84 |
| Relative PSA | 0.25968 |
| PolarSurfaceArea | 97.97 |
| Druglikeness | -1.3383 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-hydroxybenzamide | 2 - N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-hydroxybenzamide