| MolName | 2-(1,3-benzodioxol-5-ylamino)-N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]acetamide |
| MolecularFormula | C23H19N5O3S |
| Smiles | O=C(CNc(cc1)cc2c1OCO2)N/N=C\c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C23H19N5O3S/c29-22(13-24-17-8-9-19-20(11-17)31-15-30-19)26-25-12-16-14-28(18-5-2-1-3-6-18)27-23(16)21-7-4-10-32-21/h1-12,14,24H,13,15H2,(H,26,29) |
| InChIK | DGNQTZWHEDELOI-UHFFFAOYSA-N |
| TotalMolweight | 445.502 |
| Molweight | 445.502 |
| MonoisotopicMass | 445.12086 |
| CLogP | 3.5474 |
| CLogS | -5.688 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 335.89 |
| Relative PSA | 0.3146 |
| PolarSurfaceArea | 118.01 |
| Druglikeness | 7.6476 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzodioxol-5-ylamino)-N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]acetamide | 2 - 2-(1,3-benzodioxol-5-ylamino)-N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]acetamide