| MolName | 4-(2,4-dichlorophenoxy)-N-[2-oxo-2-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]ethyl]butanamide |
| MolecularFormula | C21H21N3O3Cl2 |
| Smiles | O=C(CCCOc(ccc(Cl)c1)c1Cl)NCC(N/N=C\C=C\c1ccccc1)=O |
| InChI | InChI=1S/C21H21Cl2N3O3/c22-17-10-11-19(18(23)14-17)29-13-5-9-20(27)24-15-21(28)26-25-12-4-8-16-6-2-1-3-7-16/h1-4,6-8,10-12,14H,5,9,13,15H2,(H,24,27)(H,26,28) |
| InChIK | DGTAYEXPCHZZQK-UHFFFAOYSA-N |
| TotalMolweight | 434.322 |
| Molweight | 434.322 |
| MonoisotopicMass | 433.095996 |
| CLogP | 3.9993 |
| CLogS | -5.572 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 338.58 |
| Relative PSA | 0.20825 |
| PolarSurfaceArea | 79.79 |
| Druglikeness | 1.4447 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75862 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 10 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(2,4-dichlorophenoxy)-N-[2-oxo-2-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]ethyl]butanamide | 2 - 4-(2,4-dichlorophenoxy)-N-[2-oxo-2-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]ethyl]butanamide