| MolName | N-[(1S)-2-[(2Z)-2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| MolecularFormula | C31H24N5O4Cl |
| Smiles | O=C([C@H](C(c1c2cccc1)=NNC2=O)NC(c1ccccc1)=O)N/N=C\c(cccc1)c1OCc(cc1)ccc1Cl |
| InChI | InChI=1S/C31H24ClN5O4/c32-23-16-14-20(15-17-23)19-41-26-13-7-4-10-22(26)18-33-36-31(40)28(34-29(38)21-8-2-1-3-9-21)27-24-11-5-6-12-25(24)30(39)37-35-27/h1-18,28H,19H2,(H,34,38)(H,36,40)(H,37,39)/t28-/m0/s1 |
| InChIK | DHMVGZYFRCHPLD-NDEPHWFRSA-N |
| TotalMolweight | 566.016 |
| Molweight | 566.016 |
| MonoisotopicMass | 565.151682 |
| CLogP | 5.0872 |
| CLogS | -7.954 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 426.08 |
| Relative PSA | 0.25 |
| PolarSurfaceArea | 121.25 |
| Druglikeness | 6.6787 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.4878 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| StereoCenters | 1 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - N-[(1S)-2-[(2Z)-2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide | 2 - N-[(1S)-2-[(2Z)-2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide