| MolName | N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[4-[(2-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]acetamide |
| MolecularFormula | C20H23N5O3Cl2 |
| Smiles | [O-][N+](c(cc1)cc(/C=N\NC(C[NH+]2CC[NH+](Cc(cccc3)c3Cl)CC2)=O)c1Cl)=O |
| InChI | InChI=1S/C20H21Cl2N5O3/c21-18-4-2-1-3-15(18)13-25-7-9-26(10-8-25)14-20(28)24-23-12-16-11-17(27(29)30)5-6-19(16)22/h1-6,11-12H,7-10,13-14H2,(H,24,28)/p+2 |
| InChIK | DIOWYPMYYHTZRG-UHFFFAOYSA-P |
| TotalMolweight | 452.341 |
| Molweight | 452.341 |
| MonoisotopicMass | 451.117794 |
| CLogP | 1.2484 |
| CLogS | -4.498 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 359.24 |
| Relative PSA | 0.28285 |
| PolarSurfaceArea | 96.16 |
| Druglikeness | -0.73119 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 2 |
| Amines | 2 |
| AlkylAmines | 2 |
| BasicNitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[4-[(2-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]acetamide | 2 - N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[4-[(2-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]acetamide