| MolName | [1-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| MolecularFormula | C26H16N2O5Cl2 |
| Smiles | O=C(c(cc1)cc2c1OCO2)N/N=C\c(c1ccccc1cc1)c1OC(c(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C26H16Cl2N2O5/c27-17-7-8-19(21(28)12-17)26(32)35-22-9-5-15-3-1-2-4-18(15)20(22)13-29-30-25(31)16-6-10-23-24(11-16)34-14-33-23/h1-13H,14H2,(H,30,31) |
| InChIK | DIQORPDOAUNOSG-UHFFFAOYSA-N |
| TotalMolweight | 507.328 |
| Molweight | 507.328 |
| MonoisotopicMass | 506.043627 |
| CLogP | 7.1499 |
| CLogS | -8.98 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 360.2 |
| Relative PSA | 0.21946 |
| PolarSurfaceArea | 86.22 |
| Druglikeness | 4.0013 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]naphthalen-2-yl] 2,4-dichlorobenzoate | 2 - [1-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]naphthalen-2-yl] 2,4-dichlorobenzoate