| MolName | (Z)-1-(5-bromo-2-fluorophenyl)-N-[4-(9H-fluoren-9-yl)piperazin-1-yl]methanimine |
| MolecularFormula | C24H21N3BrF |
| Smiles | Fc(cc1)c(/C=N\N(CC2)CCN2C2c(cccc3)c3-c3c2cccc3)cc1Br |
| InChI | InChI=1S/C24H21BrFN3/c25-18-9-10-23(26)17(15-18)16-27-29-13-11-28(12-14-29)24-21-7-3-1-5-19(21)20-6-2-4-8-22(20)24/h1-10,15-16,24H,11-14H2 |
| InChIK | DITPDGOIJKKCJS-UHFFFAOYSA-N |
| TotalMolweight | 450.354 |
| Molweight | 450.354 |
| MonoisotopicMass | 449.090286 |
| CLogP | 5.7348 |
| CLogS | -6.064 |
| H Acceptors | 3 |
| TotalSurfaceArea | 303.66 |
| Relative PSA | 0.061286 |
| PolarSurfaceArea | 18.84 |
| Druglikeness | 3.836 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 8 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(5-bromo-2-fluorophenyl)-N-[4-(9H-fluoren-9-yl)piperazin-1-yl]methanimine | 2 - (Z)-1-(5-bromo-2-fluorophenyl)-N-[4-(9H-fluoren-9-yl)piperazin-1-yl]methanimine